About tetrabutylazanium;trifluoromethanesulfonic acid
tetrabutylazanium;trifluoromethanesulfonic acid (PubChem CID 617967) has the molecular formula C17H37F3NO3S+
and a molecular weight of 392.55 g/mol. Its IUPAC name is tetrabutylazanium;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | tetrabutylazanium;trifluoromethanesulfonic acid |
| PubChem CID | 617967 |
| Molecular Formula | C17H37F3NO3S+ |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | tetrabutylazanium;trifluoromethanesulfonic acid |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C16H36N.CHF3O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)8(5,6)7/h5-16H2,1-4H3;(H,5,6,7)/q+1; |
| InChIKey | YNJQKNVVBBIPBA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;trifluoromethanesulfonic acid?
The IUPAC name of tetrabutylazanium;trifluoromethanesulfonic acid (CID 617967) is tetrabutylazanium;trifluoromethanesulfonic acid.
What is the SMILES notation for tetrabutylazanium;trifluoromethanesulfonic acid?
The canonical SMILES for tetrabutylazanium;trifluoromethanesulfonic acid is CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of tetrabutylazanium;trifluoromethanesulfonic acid?
The InChIKey is YNJQKNVVBBIPBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.CHF3O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)8(5,6)7/h5-16H2,1-4H3;(H,5,6,7)/q+1;.
What are the key properties of tetrabutylazanium;trifluoromethanesulfonic acid?
tetrabutylazanium;trifluoromethanesulfonic acid has a molecular weight of 392.55 g/mol, XLogP of 5.40, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;trifluoromethanesulfonic acid is sourced from PubChem (CID 617967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).