About [(E)-(3,3,5-trimethylcyclohexylidene)amino]urea
[(E)-(3,3,5-trimethylcyclohexylidene)amino]urea (PubChem CID 6181691) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is [(E)-(3,3,5-trimethylcyclohexylidene)amino]urea.
Molecular Properties
| Compound Name | [(E)-(3,3,5-trimethylcyclohexylidene)amino]urea |
| PubChem CID | 6181691 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | [(E)-(3,3,5-trimethylcyclohexylidene)amino]urea |
| SMILES | CC1C/C(=N\NC(N)=O)CC(C)(C)C1 |
| InChI | InChI=1S/C10H19N3O/c1-7-4-8(12-13-9(11)14)6-10(2,3)5-7/h7H,4-6H2,1-3H3,(H3,11,13,14)/b12-8+ |
| InChIKey | GPOZBXAWJMJAJE-XYOKQWHBSA-N |
| XLogP | 1.86 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(3,3,5-trimethylcyclohexylidene)amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(3,3,5-trimethylcyclohexylidene)amino]urea?
The IUPAC name of [(E)-(3,3,5-trimethylcyclohexylidene)amino]urea (CID 6181691) is [(E)-(3,3,5-trimethylcyclohexylidene)amino]urea.
What is the SMILES notation for [(E)-(3,3,5-trimethylcyclohexylidene)amino]urea?
The canonical SMILES for [(E)-(3,3,5-trimethylcyclohexylidene)amino]urea is CC1C/C(=N\NC(N)=O)CC(C)(C)C1.
What is the InChIKey of [(E)-(3,3,5-trimethylcyclohexylidene)amino]urea?
The InChIKey is GPOZBXAWJMJAJE-XYOKQWHBSA-N. The full InChI is InChI=1S/C10H19N3O/c1-7-4-8(12-13-9(11)14)6-10(2,3)5-7/h7H,4-6H2,1-3H3,(H3,11,13,14)/b12-8+.
What are the key properties of [(E)-(3,3,5-trimethylcyclohexylidene)amino]urea?
[(E)-(3,3,5-trimethylcyclohexylidene)amino]urea has a molecular weight of 197.28 g/mol, XLogP of 1.86, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(3,3,5-trimethylcyclohexylidene)amino]urea is sourced from PubChem (CID 6181691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).