C28H23ClN2O4 — CID 6182256
N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenoxyacetamide (PubChem CID 6182256) has the molecular formula C28H23ClN2O4 and a molecular weight of 486.96 g/mol. Its IUPAC name is N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenoxyacetamide.
| Compound Name | N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenoxyacetamide |
|---|---|
| PubChem CID | 6182256 |
| Molecular Formula | C28H23ClN2O4 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenoxyacetamide |
| SMILES | O=C(N/N=C\c1cccc(OCc2ccc(Cl)cc2)c1)C(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C28H23ClN2O4/c29-23-16-14-21(15-17-23)20-33-26-13-7-8-22(18-26)19-30-31-27(32)28(34-24-9-3-1-4-10-24)35-25-11-5-2-6-12-25/h1-19,28H,20H2,(H,31,32)/b30-19- |
| InChIKey | SFHCMXDJZOZGAU-FSGOGVSDSA-N |
| XLogP | 5.85 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|