About 2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one
2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 618314) has the molecular formula C12H9N3OS
and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| PubChem CID | 618314 |
| Molecular Formula | C12H9N3OS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cc1nn2c(=O)cc(-c3ccccc3)nc2s1 |
| InChI | InChI=1S/C12H9N3OS/c1-8-14-15-11(16)7-10(13-12(15)17-8)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | NQWOQIXDRWODSL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one?
The IUPAC name of 2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (CID 618314) is 2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
What is the SMILES notation for 2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one?
The canonical SMILES for 2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one is Cc1nn2c(=O)cc(-c3ccccc3)nc2s1.
What is the InChIKey of 2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one?
The InChIKey is NQWOQIXDRWODSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3OS/c1-8-14-15-11(16)7-10(13-12(15)17-8)9-5-3-2-4-6-9/h2-7H,1H3.
What are the key properties of 2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one?
2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one has a molecular weight of 243.29 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one is sourced from PubChem (CID 618314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).