C32H35NO7 — CID 618344
methyl 2-[2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2-oxazolidine-5-carboxylate (PubChem CID 618344) has the molecular formula C32H35NO7 and a molecular weight of 545.63 g/mol. Its IUPAC name is methyl 2-[2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2-oxazolidine-5-carboxylate.
| Compound Name | methyl 2-[2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 618344 |
| Molecular Formula | C32H35NO7 |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | methyl 2-[2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2-oxazolidine-5-carboxylate |
| SMILES | COC(=O)C1CCN(C2OC(COC(c3ccccc3)(c3ccccc3)c3ccccc3)C3OC(C)(C)OC32)O1 |
| InChI | InChI=1S/C32H35NO7/c1-31(2)38-27-26(37-29(28(27)39-31)33-20-19-25(40-33)30(34)35-3)21-36-32(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-18,25-29H,19-21H2,1-3H3 |
| InChIKey | WPSIXPIZLUMVGN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|