C17H15BrO2 — CID 61834439
6-((3-Bromophenyl)methoxy)-1,2,3,4-tetrahydronaphthalen-1-one (PubChem CID 61834439) has the molecular formula C17H15BrO2 and a molecular weight of 331.20 g/mol. Its IUPAC name is 6-[(3-bromophenyl)methoxy]-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 6-((3-Bromophenyl)methoxy)-1,2,3,4-tetrahydronaphthalen-1-one |
|---|---|
| PubChem CID | 61834439 |
| Molecular Formula | C17H15BrO2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 6-[(3-bromophenyl)methoxy]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | C1CC2=C(C=CC(=C2)OCC3=CC(=CC=C3)Br)C(=O)C1 |
| InChI | InChI=1S/C17H15BrO2/c18-14-5-1-3-12(9-14)11-20-15-7-8-16-13(10-15)4-2-6-17(16)19/h1,3,5,7-10H,2,4,6,11H2 |
| InChIKey | XEWIJBLUIQWBRA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | 344 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |