C13H12F5NO — CID 6183943
(E)-1-[benzyl(methyl)amino]-4,4,5,5,5-pentafluoropent-1-en-3-one (PubChem CID 6183943) has the molecular formula C13H12F5NO and a molecular weight of 293.24 g/mol. Its IUPAC name is (E)-1-[benzyl(methyl)amino]-4,4,5,5,5-pentafluoropent-1-en-3-one.
| Compound Name | (E)-1-[benzyl(methyl)amino]-4,4,5,5,5-pentafluoropent-1-en-3-one |
|---|---|
| PubChem CID | 6183943 |
| Molecular Formula | C13H12F5NO |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (E)-1-[benzyl(methyl)amino]-4,4,5,5,5-pentafluoropent-1-en-3-one |
| SMILES | CN(/C=C/C(=O)C(F)(F)C(F)(F)F)Cc1ccccc1 |
| InChI | InChI=1S/C13H12F5NO/c1-19(9-10-5-3-2-4-6-10)8-7-11(20)12(14,15)13(16,17)18/h2-8H,9H2,1H3/b8-7+ |
| InChIKey | WDHPKGMMEZURPK-BQYQJAHWSA-N |
| XLogP | 3.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|