C16H24Si — CID 618506
3,8-diethyl-1,4,6,9-tetramethyl-5-silaspiro[4.4]nona-1,3,6,8-tetraene (PubChem CID 618506) has the molecular formula C16H24Si and a molecular weight of 244.45 g/mol. Its IUPAC name is 3,8-diethyl-1,4,6,9-tetramethyl-5-silaspiro[4.4]nona-1,3,6,8-tetraene.
| Compound Name | 3,8-diethyl-1,4,6,9-tetramethyl-5-silaspiro[4.4]nona-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 618506 |
| Molecular Formula | C16H24Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 3,8-diethyl-1,4,6,9-tetramethyl-5-silaspiro[4.4]nona-1,3,6,8-tetraene |
| SMILES | CCC1=C(C)[Si]2(C(C)=C1)C(C)=CC(CC)=C2C |
| InChI | InChI=1S/C16H24Si/c1-7-15-9-11(3)17(13(15)5)12(4)10-16(8-2)14(17)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | PHJBFGIPQCTNCS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|