About (6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol
(6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol (PubChem CID 618527) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is (6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol.
Molecular Properties
| Compound Name | (6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol |
| PubChem CID | 618527 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol |
| SMILES | COc1cccc2c3c(c(C)nc12)CC(CO)O3 |
| InChI | InChI=1S/C14H15NO3/c1-8-11-6-9(7-16)18-14(11)10-4-3-5-12(17-2)13(10)15-8/h3-5,9,16H,6-7H2,1-2H3 |
| InChIKey | AHRUYAPSQSWEIJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol?
The IUPAC name of (6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol (CID 618527) is (6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol.
What is the SMILES notation for (6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol?
The canonical SMILES for (6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol is COc1cccc2c3c(c(C)nc12)CC(CO)O3.
What is the InChIKey of (6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol?
The InChIKey is AHRUYAPSQSWEIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3/c1-8-11-6-9(7-16)18-14(11)10-4-3-5-12(17-2)13(10)15-8/h3-5,9,16H,6-7H2,1-2H3.
What are the key properties of (6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol?
(6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol has a molecular weight of 245.28 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinolin-2-yl)methanol is sourced from PubChem (CID 618527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).