About 5,6-dichloro-1H-imidazo[4,5-b]pyrazine
5,6-dichloro-1H-imidazo[4,5-b]pyrazine (PubChem CID 6185514) has the molecular formula C5H2Cl2N4
and a molecular weight of 189.01 g/mol. Its IUPAC name is 5,6-dichloro-1H-imidazo[4,5-b]pyrazine.
Molecular Properties
| Compound Name | 5,6-dichloro-1H-imidazo[4,5-b]pyrazine |
| PubChem CID | 6185514 |
| Molecular Formula | C5H2Cl2N4 |
| Molecular Weight | 189.01 g/mol |
| Exact Mass | 187.97 |
| IUPAC Name | 5,6-dichloro-1H-imidazo[4,5-b]pyrazine |
| SMILES | Clc1nc2nc[nH]c2nc1Cl |
| InChI | InChI=1S/C5H2Cl2N4/c6-2-3(7)11-5-4(10-2)8-1-9-5/h1H,(H,8,9,10,11) |
| InChIKey | MIQQJOMFMVDFTH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.01 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dichloro-1H-imidazo[4,5-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-1H-imidazo[4,5-b]pyrazine?
The IUPAC name of 5,6-dichloro-1H-imidazo[4,5-b]pyrazine (CID 6185514) is 5,6-dichloro-1H-imidazo[4,5-b]pyrazine.
What is the SMILES notation for 5,6-dichloro-1H-imidazo[4,5-b]pyrazine?
The canonical SMILES for 5,6-dichloro-1H-imidazo[4,5-b]pyrazine is Clc1nc2nc[nH]c2nc1Cl.
What is the InChIKey of 5,6-dichloro-1H-imidazo[4,5-b]pyrazine?
The InChIKey is MIQQJOMFMVDFTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2Cl2N4/c6-2-3(7)11-5-4(10-2)8-1-9-5/h1H,(H,8,9,10,11).
What are the key properties of 5,6-dichloro-1H-imidazo[4,5-b]pyrazine?
5,6-dichloro-1H-imidazo[4,5-b]pyrazine has a molecular weight of 189.01 g/mol, XLogP of 1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-1H-imidazo[4,5-b]pyrazine is sourced from PubChem (CID 6185514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).