C29H26N4O6S — CID 6185846
(6Z)-5-imino-6-[[3-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 6185846) has the molecular formula C29H26N4O6S and a molecular weight of 558.62 g/mol. Its IUPAC name is (6Z)-5-imino-6-[[3-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-5-imino-6-[[3-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 6185846 |
| Molecular Formula | C29H26N4O6S |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | (6Z)-5-imino-6-[[3-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2ccc(OCCOc3cccc(OC)c3)c(OC)c2)/C(=O)N=C2SC(COc3ccccc3)=NN2/1 |
| InChI | InChI=1S/C29H26N4O6S/c1-35-21-9-6-10-22(17-21)37-13-14-38-24-12-11-19(16-25(24)36-2)15-23-27(30)33-29(31-28(23)34)40-26(32-33)18-39-20-7-4-3-5-8-20/h3-12,15-17,30H,13-14,18H2,1-2H3/b23-15-,30-27- |
| InChIKey | UGIVKBNAEAWLRC-KWSKTOGSSA-N |
| XLogP | 4.86 |
| TPSA | 115.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|