About [(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate
[(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate (PubChem CID 6188295) has the molecular formula C21H25NO4
and a molecular weight of 355.43 g/mol. Its IUPAC name is [(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate.
Molecular Properties
| Compound Name | [(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate |
| PubChem CID | 6188295 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)O/N=C2\C=C(C(C)C)C(=O)C=C2C)cc1 |
| InChI | InChI=1S/C21H25NO4/c1-5-6-11-25-17-9-7-16(8-10-17)21(24)26-22-19-13-18(14(2)3)20(23)12-15(19)4/h7-10,12-14H,5-6,11H2,1-4H3/b22-19+ |
| InChIKey | IUZYDWFNJRPOBK-ZBJSNUHESA-N |
| XLogP | 4.49 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate?
The IUPAC name of [(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate (CID 6188295) is [(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate.
What is the SMILES notation for [(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate?
The canonical SMILES for [(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate is CCCCOc1ccc(C(=O)O/N=C2\C=C(C(C)C)C(=O)C=C2C)cc1.
What is the InChIKey of [(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate?
The InChIKey is IUZYDWFNJRPOBK-ZBJSNUHESA-N. The full InChI is InChI=1S/C21H25NO4/c1-5-6-11-25-17-9-7-16(8-10-17)21(24)26-22-19-13-18(14(2)3)20(23)12-15(19)4/h7-10,12-14H,5-6,11H2,1-4H3/b22-19+.
What are the key properties of [(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate?
[(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate has a molecular weight of 355.43 g/mol, XLogP of 4.49, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-butoxybenzoate is sourced from PubChem (CID 6188295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).