About 2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one
2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one (PubChem CID 618947) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one |
| PubChem CID | 618947 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one |
| SMILES | CN(C)N=C1C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C16H26N2O/c1-15(2,3)12-9-11(17-18(7)8)10-13(14(12)19)16(4,5)6/h9-10H,1-8H3 |
| InChIKey | YUKBWKYIIHDBSL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one?
The IUPAC name of 2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one (CID 618947) is 2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one.
What is the SMILES notation for 2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one?
The canonical SMILES for 2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one is CN(C)N=C1C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1.
What is the InChIKey of 2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one?
The InChIKey is YUKBWKYIIHDBSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O/c1-15(2,3)12-9-11(17-18(7)8)10-13(14(12)19)16(4,5)6/h9-10H,1-8H3.
What are the key properties of 2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one?
2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one has a molecular weight of 262.40 g/mol, XLogP of 3.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-(dimethylhydrazinylidene)cyclohexa-2,5-dien-1-one is sourced from PubChem (CID 618947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).