C6H10Br4O2 — CID 619017
1,3,5,6-tetrabromohexane-2,4-diol (PubChem CID 619017) has the molecular formula C6H10Br4O2 and a molecular weight of 433.76 g/mol. Its IUPAC name is 1,3,5,6-tetrabromohexane-2,4-diol.
| Compound Name | 1,3,5,6-tetrabromohexane-2,4-diol |
|---|---|
| PubChem CID | 619017 |
| Molecular Formula | C6H10Br4O2 |
| Molecular Weight | 433.76 g/mol |
| Exact Mass | 429.74 |
| IUPAC Name | 1,3,5,6-tetrabromohexane-2,4-diol |
| SMILES | OC(CBr)C(Br)C(O)C(Br)CBr |
| InChI | InChI=1S/C6H10Br4O2/c7-1-3(9)6(12)5(10)4(11)2-8/h3-6,11-12H,1-2H2 |
| InChIKey | AZHQESOSXYTRHB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.76 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|