C16H13N3 — CID 619020
2,6-diphenylpyrimidin-4-amine (PubChem CID 619020) has the molecular formula C16H13N3 and a molecular weight of 247.30 g/mol. Its IUPAC name is 2,6-diphenylpyrimidin-4-amine.
| Compound Name | 2,6-diphenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 619020 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2,6-diphenylpyrimidin-4-amine |
| SMILES | Nc1cc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H13N3/c17-15-11-14(12-7-3-1-4-8-12)18-16(19-15)13-9-5-2-6-10-13/h1-11H,(H2,17,18,19) |
| InChIKey | PLXFRDQUOPPVHF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |