C26H29N3O5 — CID 6190283
1-[3-(diethylamino)propyl]-4-hydroxy-2-(4-nitrophenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6190283) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-4-hydroxy-2-(4-nitrophenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 1-[3-(diethylamino)propyl]-4-hydroxy-2-(4-nitrophenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6190283 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-4-hydroxy-2-(4-nitrophenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | CCN(CC)CCCN1C(=O)C(O)=C(C(=O)/C=C/c2ccccc2)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H29N3O5/c1-3-27(4-2)17-8-18-28-24(20-12-14-21(15-13-20)29(33)34)23(25(31)26(28)32)22(30)16-11-19-9-6-5-7-10-19/h5-7,9-16,24,31H,3-4,8,17-18H2,1-2H3/b16-11+ |
| InChIKey | XYEFRHMPFBQOBL-LFIBNONCSA-N |
| XLogP | 4.30 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|