C31H28BrN3O4 — CID 6190519
(4E)-5-(3-bromophenyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 6190519) has the molecular formula C31H28BrN3O4 and a molecular weight of 586.49 g/mol. Its IUPAC name is (4E)-5-(3-bromophenyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-bromophenyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6190519 |
| Molecular Formula | C31H28BrN3O4 |
| Molecular Weight | 586.49 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | (4E)-5-(3-bromophenyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cccc(COc2ccc(/C(O)=C3\C(=O)C(=O)N(CCCn4ccnc4)C3c3cccc(Br)c3)cc2)c1 |
| InChI | InChI=1S/C31H28BrN3O4/c1-21-5-2-6-22(17-21)19-39-26-11-9-23(10-12-26)29(36)27-28(24-7-3-8-25(32)18-24)35(31(38)30(27)37)15-4-14-34-16-13-33-20-34/h2-3,5-13,16-18,20,28,36H,4,14-15,19H2,1H3/b29-27+ |
| InChIKey | DBZMAQRUJZUCHV-ORIPQNMZSA-N |
| XLogP | 6.05 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|