C30H30Cl2N2O4 — CID 6190558
(4E)-5-(3,4-dichlorophenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione (PubChem CID 6190558) has the molecular formula C30H30Cl2N2O4 and a molecular weight of 553.49 g/mol. Its IUPAC name is (4E)-5-(3,4-dichlorophenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3,4-dichlorophenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6190558 |
| Molecular Formula | C30H30Cl2N2O4 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | (4E)-5-(3,4-dichlorophenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione |
| SMILES | Cc1cccc(COc2ccc(/C(O)=C3\C(=O)C(=O)N(CCCN(C)C)C3c3ccc(Cl)c(Cl)c3)cc2)c1 |
| InChI | InChI=1S/C30H30Cl2N2O4/c1-19-6-4-7-20(16-19)18-38-23-11-8-21(9-12-23)28(35)26-27(22-10-13-24(31)25(32)17-22)34(30(37)29(26)36)15-5-14-33(2)3/h4,6-13,16-17,27,35H,5,14-15,18H2,1-3H3/b28-26+ |
| InChIKey | DZKXPHIFLLNROB-BYCLXTJYSA-N |
| XLogP | 6.25 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|