C12H12N2O4 — CID 619094
5,10-diazatetracyclo[8.2.1.12,5.03,12]tetradecane-4,11,13,14-tetrone (PubChem CID 619094) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 5,10-diazatetracyclo[8.2.1.12,5.03,12]tetradecane-4,11,13,14-tetrone.
| Compound Name | 5,10-diazatetracyclo[8.2.1.12,5.03,12]tetradecane-4,11,13,14-tetrone |
|---|---|
| PubChem CID | 619094 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5,10-diazatetracyclo[8.2.1.12,5.03,12]tetradecane-4,11,13,14-tetrone |
| SMILES | O=C1C2C3C(=O)N1CCCCN1C(=O)C2C3C1=O |
| InChI | InChI=1S/C12H12N2O4/c15-9-5-6-8-7(5)11(17)14(12(8)18)4-2-1-3-13(9)10(6)16/h5-8H,1-4H2 |
| InChIKey | GTYORRZRUMMGNJ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|