C5H4N4O3Se — CID 619095
4-methyl-1-oxido-[1,2,5]selenadiazolo[3,4-d]pyrimidin-1-ium-5,7-dione (PubChem CID 619095) has the molecular formula C5H4N4O3Se and a molecular weight of 247.07 g/mol. Its IUPAC name is 4-methyl-1-oxido-[1,2,5]selenadiazolo[3,4-d]pyrimidin-1-ium-5,7-dione.
| Compound Name | 4-methyl-1-oxido-[1,2,5]selenadiazolo[3,4-d]pyrimidin-1-ium-5,7-dione |
|---|---|
| PubChem CID | 619095 |
| Molecular Formula | C5H4N4O3Se |
| Molecular Weight | 247.07 g/mol |
| Exact Mass | 247.94 |
| IUPAC Name | 4-methyl-1-oxido-[1,2,5]selenadiazolo[3,4-d]pyrimidin-1-ium-5,7-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1n[se][n+]2[O-] |
| InChI | InChI=1S/C5H4N4O3Se/c1-8-3-2(9(12)13-7-3)4(10)6-5(8)11/h1H3,(H,6,10,11) |
| InChIKey | SCEJTOQPYFSRLU-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.07 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|