C36H29N3O6S2 — CID 6191128
methyl 4-[(3E)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 6191128) has the molecular formula C36H29N3O6S2 and a molecular weight of 663.78 g/mol. Its IUPAC name is methyl 4-[(3E)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(3E)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 6191128 |
| Molecular Formula | C36H29N3O6S2 |
| Molecular Weight | 663.78 g/mol |
| Exact Mass | 663.15 |
| IUPAC Name | methyl 4-[(3E)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2/C(=C(\O)c3ccc(OCc4cccc(C)c4)cc3)C(=O)C(=O)N2c2nnc(SCc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C36H29N3O6S2/c1-22-7-6-10-24(19-22)20-45-28-17-15-26(16-18-28)31(40)29-30(25-11-13-27(14-12-25)34(43)44-2)39(33(42)32(29)41)35-37-38-36(47-35)46-21-23-8-4-3-5-9-23/h3-19,30,40H,20-21H2,1-2H3/b31-29+ |
| InChIKey | UUCRGLZCURZTES-OWWNRXNESA-N |
| XLogP | 7.13 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.78 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|