About 1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione
1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione (PubChem CID 619179) has the molecular formula C12H16N4O2
and a molecular weight of 248.29 g/mol. Its IUPAC name is 1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione.
Molecular Properties
| Compound Name | 1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione |
| PubChem CID | 619179 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=NC1(CCCCC1)N=2 |
| InChI | InChI=1S/C12H16N4O2/c1-15-9-8(10(17)16(2)11(15)18)13-12(14-9)6-4-3-5-7-12/h3-7H2,1-2H3 |
| InChIKey | TWIOWKHTTGCXPK-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 68.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione?
The IUPAC name of 1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione (CID 619179) is 1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione.
What is the SMILES notation for 1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione?
The canonical SMILES for 1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione is Cn1c(=O)c2c(n(C)c1=O)=NC1(CCCCC1)N=2.
What is the InChIKey of 1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione?
The InChIKey is TWIOWKHTTGCXPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2/c1-15-9-8(10(17)16(2)11(15)18)13-12(14-9)6-4-3-5-7-12/h3-7H2,1-2H3.
What are the key properties of 1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione?
1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione has a molecular weight of 248.29 g/mol, XLogP of -1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1',3'-dimethylspiro[cyclohexane-1,8'-purine]-2',6'-dione is sourced from PubChem (CID 619179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).