About 2-chloro-1,4-bis(trifluoromethyl)benzene
2-chloro-1,4-bis(trifluoromethyl)benzene (PubChem CID 619189) has the molecular formula C8H3ClF6
and a molecular weight of 248.55 g/mol. Its IUPAC name is 2-chloro-1,4-bis(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 2-chloro-1,4-bis(trifluoromethyl)benzene |
| PubChem CID | 619189 |
| Molecular Formula | C8H3ClF6 |
| Molecular Weight | 248.55 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 2-chloro-1,4-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1ccc(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C8H3ClF6/c9-6-3-4(7(10,11)12)1-2-5(6)8(13,14)15/h1-3H |
| InChIKey | IDNVTCBYGYOPKJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-chloro-1,4-bis(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,4-bis(trifluoromethyl)benzene?
The IUPAC name of 2-chloro-1,4-bis(trifluoromethyl)benzene (CID 619189) is 2-chloro-1,4-bis(trifluoromethyl)benzene.
What is the SMILES notation for 2-chloro-1,4-bis(trifluoromethyl)benzene?
The canonical SMILES for 2-chloro-1,4-bis(trifluoromethyl)benzene is FC(F)(F)c1ccc(C(F)(F)F)c(Cl)c1.
What is the InChIKey of 2-chloro-1,4-bis(trifluoromethyl)benzene?
The InChIKey is IDNVTCBYGYOPKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3ClF6/c9-6-3-4(7(10,11)12)1-2-5(6)8(13,14)15/h1-3H.
What are the key properties of 2-chloro-1,4-bis(trifluoromethyl)benzene?
2-chloro-1,4-bis(trifluoromethyl)benzene has a molecular weight of 248.55 g/mol, XLogP of 4.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,4-bis(trifluoromethyl)benzene is sourced from PubChem (CID 619189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).