About 2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole
2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole (PubChem CID 619222) has the molecular formula C17H16N2
and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole.
Molecular Properties
| Compound Name | 2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole |
| PubChem CID | 619222 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole |
| SMILES | c1ccc(N2CC3CCc4ccccc4C3=N2)cc1 |
| InChI | InChI=1S/C17H16N2/c1-2-7-15(8-3-1)19-12-14-11-10-13-6-4-5-9-16(13)17(14)18-19/h1-9,14H,10-12H2 |
| InChIKey | AZVVFDRHHIKULU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole?
The IUPAC name of 2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole (CID 619222) is 2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole.
What is the SMILES notation for 2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole?
The canonical SMILES for 2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole is c1ccc(N2CC3CCc4ccccc4C3=N2)cc1.
What is the InChIKey of 2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole?
The InChIKey is AZVVFDRHHIKULU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2/c1-2-7-15(8-3-1)19-12-14-11-10-13-6-4-5-9-16(13)17(14)18-19/h1-9,14H,10-12H2.
What are the key properties of 2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole?
2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole has a molecular weight of 248.33 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole is sourced from PubChem (CID 619222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).