About 1,6-dichlorophenazine
1,6-dichlorophenazine (PubChem CID 619227) has the molecular formula C12H6Cl2N2
and a molecular weight of 249.10 g/mol. Its IUPAC name is 1,6-dichlorophenazine.
Molecular Properties
| Compound Name | 1,6-dichlorophenazine |
| PubChem CID | 619227 |
| Molecular Formula | C12H6Cl2N2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 1,6-dichlorophenazine |
| SMILES | Clc1cccc2nc3c(Cl)cccc3nc12 |
| InChI | InChI=1S/C12H6Cl2N2/c13-7-3-1-5-9-11(7)16-10-6-2-4-8(14)12(10)15-9/h1-6H |
| InChIKey | ODSJIHKCGKVWTE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dichlorophenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dichlorophenazine?
The IUPAC name of 1,6-dichlorophenazine (CID 619227) is 1,6-dichlorophenazine.
What is the SMILES notation for 1,6-dichlorophenazine?
The canonical SMILES for 1,6-dichlorophenazine is Clc1cccc2nc3c(Cl)cccc3nc12.
What is the InChIKey of 1,6-dichlorophenazine?
The InChIKey is ODSJIHKCGKVWTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl2N2/c13-7-3-1-5-9-11(7)16-10-6-2-4-8(14)12(10)15-9/h1-6H.
What are the key properties of 1,6-dichlorophenazine?
1,6-dichlorophenazine has a molecular weight of 249.10 g/mol, XLogP of 4.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dichlorophenazine is sourced from PubChem (CID 619227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).