C11H11N3O2S — CID 619283
4,5-dimethyl-6-thia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8-triene-2,12-dione (PubChem CID 619283) has the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. Its IUPAC name is 4,5-dimethyl-6-thia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8-triene-2,12-dione.
| Compound Name | 4,5-dimethyl-6-thia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8-triene-2,12-dione |
|---|---|
| PubChem CID | 619283 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 4,5-dimethyl-6-thia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8-triene-2,12-dione |
| SMILES | Cc1sc2nc3n(c(=O)c2c1C)NC(=O)CC3 |
| InChI | InChI=1S/C11H11N3O2S/c1-5-6(2)17-10-9(5)11(16)14-7(12-10)3-4-8(15)13-14/h3-4H2,1-2H3,(H,13,15) |
| InChIKey | XQOOUBGYHBVJRO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |