About 5-iodo-4,6-dimethylpyrimidin-2-amine
5-iodo-4,6-dimethylpyrimidin-2-amine (PubChem CID 619288) has the molecular formula C6H8IN3
and a molecular weight of 249.05 g/mol. Its IUPAC name is 5-iodo-4,6-dimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-iodo-4,6-dimethylpyrimidin-2-amine |
| PubChem CID | 619288 |
| Molecular Formula | C6H8IN3 |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 5-iodo-4,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1nc(N)nc(C)c1I |
| InChI | InChI=1S/C6H8IN3/c1-3-5(7)4(2)10-6(8)9-3/h1-2H3,(H2,8,9,10) |
| InChIKey | TVGLWQPITVHTRF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-4,6-dimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-4,6-dimethylpyrimidin-2-amine?
The IUPAC name of 5-iodo-4,6-dimethylpyrimidin-2-amine (CID 619288) is 5-iodo-4,6-dimethylpyrimidin-2-amine.
What is the SMILES notation for 5-iodo-4,6-dimethylpyrimidin-2-amine?
The canonical SMILES for 5-iodo-4,6-dimethylpyrimidin-2-amine is Cc1nc(N)nc(C)c1I.
What is the InChIKey of 5-iodo-4,6-dimethylpyrimidin-2-amine?
The InChIKey is TVGLWQPITVHTRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8IN3/c1-3-5(7)4(2)10-6(8)9-3/h1-2H3,(H2,8,9,10).
What are the key properties of 5-iodo-4,6-dimethylpyrimidin-2-amine?
5-iodo-4,6-dimethylpyrimidin-2-amine has a molecular weight of 249.05 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-4,6-dimethylpyrimidin-2-amine is sourced from PubChem (CID 619288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).