C11H11N5S2 — CID 619350
7-methylsulfanyl-10-thia-3,4,5,6,8-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 619350) has the molecular formula C11H11N5S2 and a molecular weight of 277.38 g/mol. Its IUPAC name is 7-methylsulfanyl-10-thia-3,4,5,6,8-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 7-methylsulfanyl-10-thia-3,4,5,6,8-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 619350 |
| Molecular Formula | C11H11N5S2 |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 7-methylsulfanyl-10-thia-3,4,5,6,8-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | CSc1nc2sc3c(c2c2nnnn12)CCCC3 |
| InChI | InChI=1S/C11H11N5S2/c1-17-11-12-10-8(9-13-14-15-16(9)11)6-4-2-3-5-7(6)18-10/h2-5H2,1H3 |
| InChIKey | XXFQJGPMNGGNPG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |