C13H10N6 — CID 619434
4,6-dipyridin-3-yl-1,3,5-triazin-2-amine (PubChem CID 619434) has the molecular formula C13H10N6 and a molecular weight of 250.27 g/mol. Its IUPAC name is 4,6-dipyridin-3-yl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dipyridin-3-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 619434 |
| Molecular Formula | C13H10N6 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4,6-dipyridin-3-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(-c2cccnc2)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C13H10N6/c14-13-18-11(9-3-1-5-15-7-9)17-12(19-13)10-4-2-6-16-8-10/h1-8H,(H2,14,17,18,19) |
| InChIKey | VPOCSDQXCBFIPB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |