C9H14S4 — CID 619444
1,3,5-trimethyl-2,4,6,8-tetrathiatricyclo[3.3.1.13,7]decane (PubChem CID 619444) has the molecular formula C9H14S4 and a molecular weight of 250.48 g/mol. Its IUPAC name is 1,3,5-trimethyl-2,4,6,8-tetrathiatricyclo[3.3.1.13,7]decane.
| Compound Name | 1,3,5-trimethyl-2,4,6,8-tetrathiatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 619444 |
| Molecular Formula | C9H14S4 |
| Molecular Weight | 250.48 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 1,3,5-trimethyl-2,4,6,8-tetrathiatricyclo[3.3.1.13,7]decane |
| SMILES | CC12CC3(C)SC(CC(C)(S1)S3)S2 |
| InChI | InChI=1S/C9H14S4/c1-7-4-6-10-8(2,12-7)5-9(3,11-6)13-7/h6H,4-5H2,1-3H3 |
| InChIKey | TUFSZZBOTJUUPN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |