C30H24FN5O4S2 — CID 6194779
(4E)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6194779) has the molecular formula C30H24FN5O4S2 and a molecular weight of 601.69 g/mol. Its IUPAC name is (4E)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6194779 |
| Molecular Formula | C30H24FN5O4S2 |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | (4E)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(\O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2c2nnc(SCc3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C30H24FN5O4S2/c1-16-5-4-14-35-17(2)23(32-27(16)35)25(37)22-24(19-8-12-21(40-3)13-9-19)36(28(39)26(22)38)29-33-34-30(42-29)41-15-18-6-10-20(31)11-7-18/h4-14,24,37H,15H2,1-3H3/b25-22+ |
| InChIKey | LLQGINRTJQZPGE-YYDJUVGSSA-N |
| XLogP | 5.87 |
| TPSA | 109.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|