C14H6N2O3 — CID 619491
naphtho[2,3-g][2,1,3]benzoxadiazole-6,11-dione (PubChem CID 619491) has the molecular formula C14H6N2O3 and a molecular weight of 250.21 g/mol. Its IUPAC name is naphtho[2,3-g][2,1,3]benzoxadiazole-6,11-dione.
| Compound Name | naphtho[2,3-g][2,1,3]benzoxadiazole-6,11-dione |
|---|---|
| PubChem CID | 619491 |
| Molecular Formula | C14H6N2O3 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | naphtho[2,3-g][2,1,3]benzoxadiazole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1nonc21 |
| InChI | InChI=1S/C14H6N2O3/c17-13-7-3-1-2-4-8(7)14(18)11-9(13)5-6-10-12(11)16-19-15-10/h1-6H |
| InChIKey | IRBWFAGWIIHEOF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|