About 3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one
3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one (PubChem CID 619501) has the molecular formula C14H10N4O
and a molecular weight of 250.26 g/mol. Its IUPAC name is 3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one.
Molecular Properties
| Compound Name | 3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one |
| PubChem CID | 619501 |
| Molecular Formula | C14H10N4O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one |
| SMILES | Cn1[nH]c(=O)c2cnc3c(ccc4cccnc43)c21 |
| InChI | InChI=1S/C14H10N4O/c1-18-13-9-5-4-8-3-2-6-15-11(8)12(9)16-7-10(13)14(19)17-18/h2-7H,1H3,(H,17,19) |
| InChIKey | KBOHYQLFTFOSGK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one?
The IUPAC name of 3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one (CID 619501) is 3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one.
What is the SMILES notation for 3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one?
The canonical SMILES for 3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one is Cn1[nH]c(=O)c2cnc3c(ccc4cccnc43)c21.
What is the InChIKey of 3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one?
The InChIKey is KBOHYQLFTFOSGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O/c1-18-13-9-5-4-8-3-2-6-15-11(8)12(9)16-7-10(13)14(19)17-18/h2-7H,1H3,(H,17,19).
What are the key properties of 3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one?
3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one has a molecular weight of 250.26 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2H-pyrazolo[4,3-c][1,10]phenanthrolin-1-one is sourced from PubChem (CID 619501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).