C29H20N4O5S — CID 6196608
(5'Z)-5'-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one (PubChem CID 6196608) has the molecular formula C29H20N4O5S and a molecular weight of 536.57 g/mol. Its IUPAC name is (5'Z)-5'-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one.
| Compound Name | (5'Z)-5'-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
|---|---|
| PubChem CID | 6196608 |
| Molecular Formula | C29H20N4O5S |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | (5'Z)-5'-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
| SMILES | O=C1NC2(Oc3ccccc3C3CC(c4ccccc4)=NN32)/C(=C/c2ccc(-c3cccc([N+](=O)[O-])c3)o2)S1 |
| InChI | InChI=1S/C29H20N4O5S/c34-28-30-29(27(39-28)16-21-13-14-25(37-21)19-9-6-10-20(15-19)33(35)36)32-24(22-11-4-5-12-26(22)38-29)17-23(31-32)18-7-2-1-3-8-18/h1-16,24H,17H2,(H,30,34)/b27-16- |
| InChIKey | HZDCAODIDMSCSA-YUMHPJSZSA-N |
| XLogP | 6.55 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|