About 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide (PubChem CID 619665) has the molecular formula C17H15ClN2O2S2
and a molecular weight of 378.91 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide |
| PubChem CID | 619665 |
| Molecular Formula | C17H15ClN2O2S2 |
| Molecular Weight | 378.91 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2O2S2/c18-12-5-7-13(8-6-12)22-10-9-19-16(21)11-23-17-20-14-3-1-2-4-15(14)24-17/h1-8H,9-11H2,(H,19,21) |
| InChIKey | WNNUWUFOKCHTRP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.91 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide?
The IUPAC name of 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide (CID 619665) is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide.
What is the SMILES notation for 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide?
The canonical SMILES for 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide is O=C(CSc1nc2ccccc2s1)NCCOc1ccc(Cl)cc1.
What is the InChIKey of 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide?
The InChIKey is WNNUWUFOKCHTRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN2O2S2/c18-12-5-7-13(8-6-12)22-10-9-19-16(21)11-23-17-20-14-3-1-2-4-15(14)24-17/h1-8H,9-11H2,(H,19,21).
What are the key properties of 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide?
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide has a molecular weight of 378.91 g/mol, XLogP of 4.24, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-chlorophenoxy)ethyl]acetamide is sourced from PubChem (CID 619665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).