About triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane
triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane (PubChem CID 6197792) has the molecular formula C18H32Si2
and a molecular weight of 304.63 g/mol. Its IUPAC name is triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane.
Molecular Properties
| Compound Name | triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane |
| PubChem CID | 6197792 |
| Molecular Formula | C18H32Si2 |
| Molecular Weight | 304.63 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane |
| SMILES | CC[Si](C#C/C=C/C#C[Si](CC)(CC)CC)(CC)CC |
| InChI | InChI=1S/C18H32Si2/c1-7-19(8-2,9-3)17-15-13-14-16-18-20(10-4,11-5)12-6/h13-14H,7-12H2,1-6H3/b14-13+ |
| InChIKey | NFAAVLBMWXESLY-BUHFOSPRSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.63 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane?
The IUPAC name of triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane (CID 6197792) is triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane.
What is the SMILES notation for triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane?
The canonical SMILES for triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane is CC[Si](C#C/C=C/C#C[Si](CC)(CC)CC)(CC)CC.
What is the InChIKey of triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane?
The InChIKey is NFAAVLBMWXESLY-BUHFOSPRSA-N. The full InChI is InChI=1S/C18H32Si2/c1-7-19(8-2,9-3)17-15-13-14-16-18-20(10-4,11-5)12-6/h13-14H,7-12H2,1-6H3/b14-13+.
What are the key properties of triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane?
triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane has a molecular weight of 304.63 g/mol, XLogP of 5.64, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(E)-6-triethylsilylhex-3-en-1,5-diynyl]silane is sourced from PubChem (CID 6197792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).