About trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane
trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane (PubChem CID 6197793) has the molecular formula C12H20Si2
and a molecular weight of 220.46 g/mol. Its IUPAC name is trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane.
Molecular Properties
| Compound Name | trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane |
| PubChem CID | 6197793 |
| Molecular Formula | C12H20Si2 |
| Molecular Weight | 220.46 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane |
| SMILES | C[Si](C)(C)C#C/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C12H20Si2/c1-13(2,3)11-9-7-8-10-12-14(4,5)6/h7-8H,1-6H3/b8-7+ |
| InChIKey | AIXQKVZCTRWEGP-BQYQJAHWSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane?
The IUPAC name of trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane (CID 6197793) is trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane.
What is the SMILES notation for trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane?
The canonical SMILES for trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane is C[Si](C)(C)C#C/C=C/C#C[Si](C)(C)C.
What is the InChIKey of trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane?
The InChIKey is AIXQKVZCTRWEGP-BQYQJAHWSA-N. The full InChI is InChI=1S/C12H20Si2/c1-13(2,3)11-9-7-8-10-12-14(4,5)6/h7-8H,1-6H3/b8-7+.
What are the key properties of trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane?
trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane has a molecular weight of 220.46 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(E)-6-trimethylsilylhex-3-en-1,5-diynyl]silane is sourced from PubChem (CID 6197793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).