About 3,5-dibromopyridin-4-amine
3,5-dibromopyridin-4-amine (PubChem CID 619792) has the molecular formula C5H4Br2N2
and a molecular weight of 251.91 g/mol. Its IUPAC name is 3,5-dibromopyridin-4-amine.
Molecular Properties
| Compound Name | 3,5-dibromopyridin-4-amine |
| PubChem CID | 619792 |
| Molecular Formula | C5H4Br2N2 |
| Molecular Weight | 251.91 g/mol |
| Exact Mass | 249.87 |
| IUPAC Name | 3,5-dibromopyridin-4-amine |
| SMILES | Nc1c(Br)cncc1Br |
| InChI | InChI=1S/C5H4Br2N2/c6-3-1-9-2-4(7)5(3)8/h1-2H,(H2,8,9) |
| InChIKey | MNRBVTDLMUNVLD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.91 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dibromopyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromopyridin-4-amine?
The IUPAC name of 3,5-dibromopyridin-4-amine (CID 619792) is 3,5-dibromopyridin-4-amine.
What is the SMILES notation for 3,5-dibromopyridin-4-amine?
The canonical SMILES for 3,5-dibromopyridin-4-amine is Nc1c(Br)cncc1Br.
What is the InChIKey of 3,5-dibromopyridin-4-amine?
The InChIKey is MNRBVTDLMUNVLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Br2N2/c6-3-1-9-2-4(7)5(3)8/h1-2H,(H2,8,9).
What are the key properties of 3,5-dibromopyridin-4-amine?
3,5-dibromopyridin-4-amine has a molecular weight of 251.91 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromopyridin-4-amine is sourced from PubChem (CID 619792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).