C20H16F2N2O5S — CID 6198452
(5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 6198452) has the molecular formula C20H16F2N2O5S and a molecular weight of 434.42 g/mol. Its IUPAC name is (5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6198452 |
| Molecular Formula | C20H16F2N2O5S |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | (5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(-c3ccc(F)cc3F)o2)C1=O)N1CCOCC1 |
| InChI | InChI=1S/C20H16F2N2O5S/c21-12-1-3-14(15(22)9-12)16-4-2-13(29-16)10-17-19(26)24(20(27)30-17)11-18(25)23-5-7-28-8-6-23/h1-4,9-10H,5-8,11H2/b17-10- |
| InChIKey | XNNFWYMWERAXBJ-YVLHZVERSA-N |
| XLogP | 3.12 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|