C6Cl4F2 — CID 619915
1,2,3,5-tetrachloro-4,6-difluorobenzene (PubChem CID 619915) has the molecular formula C6Cl4F2 and a molecular weight of 251.87 g/mol. Its IUPAC name is 1,2,3,5-tetrachloro-4,6-difluorobenzene.
| Compound Name | 1,2,3,5-tetrachloro-4,6-difluorobenzene |
|---|---|
| PubChem CID | 619915 |
| Molecular Formula | C6Cl4F2 |
| Molecular Weight | 251.87 g/mol |
| Exact Mass | 249.87 |
| IUPAC Name | 1,2,3,5-tetrachloro-4,6-difluorobenzene |
| SMILES | Fc1c(Cl)c(F)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6Cl4F2/c7-1-2(8)5(11)4(10)6(12)3(1)9 |
| InChIKey | PVGPCHMQECZTIK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.87 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|