About methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate
methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate (PubChem CID 6199684) has the molecular formula C10H6Cl3N3O2
and a molecular weight of 306.54 g/mol. Its IUPAC name is methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate.
Molecular Properties
| Compound Name | methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate |
| PubChem CID | 6199684 |
| Molecular Formula | C10H6Cl3N3O2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 304.95 |
| IUPAC Name | methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate |
| SMILES | COC(=O)/C(C#N)=N\Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H6Cl3N3O2/c1-18-10(17)8(4-14)15-16-9-6(12)2-5(11)3-7(9)13/h2-3,16H,1H3/b15-8- |
| InChIKey | FQOIMMYGAWAGGS-NVNXTCNLSA-N |
| XLogP | 3.11 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate?
The IUPAC name of methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate (CID 6199684) is methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate.
What is the SMILES notation for methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate?
The canonical SMILES for methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate is COC(=O)/C(C#N)=N\Nc1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate?
The InChIKey is FQOIMMYGAWAGGS-NVNXTCNLSA-N. The full InChI is InChI=1S/C10H6Cl3N3O2/c1-18-10(17)8(4-14)15-16-9-6(12)2-5(11)3-7(9)13/h2-3,16H,1H3/b15-8-.
What are the key properties of methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate?
methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate has a molecular weight of 306.54 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2Z)-2-cyano-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate is sourced from PubChem (CID 6199684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).