About methyl 2-oxooctadecanoate
methyl 2-oxooctadecanoate (PubChem CID 620002) has the molecular formula C19H36O3
and a molecular weight of 312.49 g/mol. Its IUPAC name is methyl 2-oxooctadecanoate.
Molecular Properties
| Compound Name | methyl 2-oxooctadecanoate |
| PubChem CID | 620002 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | methyl 2-oxooctadecanoate |
| SMILES | CCCCCCCCCCCCCCCCC(=O)C(=O)OC |
| InChI | InChI=1S/C19H36O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)19(21)22-2/h3-17H2,1-2H3 |
| InChIKey | URZVPVBICGXGEG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-oxooctadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-oxooctadecanoate?
The IUPAC name of methyl 2-oxooctadecanoate (CID 620002) is methyl 2-oxooctadecanoate.
What is the SMILES notation for methyl 2-oxooctadecanoate?
The canonical SMILES for methyl 2-oxooctadecanoate is CCCCCCCCCCCCCCCCC(=O)C(=O)OC.
What is the InChIKey of methyl 2-oxooctadecanoate?
The InChIKey is URZVPVBICGXGEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)19(21)22-2/h3-17H2,1-2H3.
What are the key properties of methyl 2-oxooctadecanoate?
methyl 2-oxooctadecanoate has a molecular weight of 312.49 g/mol, XLogP of 5.60, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-oxooctadecanoate is sourced from PubChem (CID 620002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).