C12H13F5OSi — CID 620011
cyclobutyloxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 620011) has the molecular formula C12H13F5OSi and a molecular weight of 296.31 g/mol. Its IUPAC name is cyclobutyloxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | cyclobutyloxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 620011 |
| Molecular Formula | C12H13F5OSi |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | cyclobutyloxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | C[Si](C)(OC1CCC1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H13F5OSi/c1-19(2,18-6-4-3-5-6)12-10(16)8(14)7(13)9(15)11(12)17/h6H,3-5H2,1-2H3 |
| InChIKey | CJRVDAJIBCRODI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|