About 2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide
2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide (PubChem CID 62001628) has the molecular formula C15H17ClN2O2S
and a molecular weight of 324.83 g/mol. Its IUPAC name is 2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide |
| PubChem CID | 62001628 |
| Molecular Formula | C15H17ClN2O2S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide |
| SMILES | Cc1cc(C)cc(N(C)S(=O)(=O)c2ccc(Cl)cc2N)c1 |
| InChI | InChI=1S/C15H17ClN2O2S/c1-10-6-11(2)8-13(7-10)18(3)21(19,20)15-5-4-12(16)9-14(15)17/h4-9H,17H2,1-3H3 |
| InChIKey | ANAAXFIUVZYPPY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide?
The IUPAC name of 2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide (CID 62001628) is 2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide.
What is the SMILES notation for 2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide?
The canonical SMILES for 2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide is Cc1cc(C)cc(N(C)S(=O)(=O)c2ccc(Cl)cc2N)c1.
What is the InChIKey of 2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide?
The InChIKey is ANAAXFIUVZYPPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClN2O2S/c1-10-6-11(2)8-13(7-10)18(3)21(19,20)15-5-4-12(16)9-14(15)17/h4-9H,17H2,1-3H3.
What are the key properties of 2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide?
2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide has a molecular weight of 324.83 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-chloro-N-(3,5-dimethylphenyl)-N-methylbenzenesulfonamide is sourced from PubChem (CID 62001628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).