About 5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one
5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one (PubChem CID 62001808) has the molecular formula C17H23N3O
and a molecular weight of 285.39 g/mol. Its IUPAC name is 5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one.
Molecular Properties
| Compound Name | 5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one |
| PubChem CID | 62001808 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one |
| SMILES | Cc1cc(C)cc(N(C)CCCn2cc(N)ccc2=O)c1 |
| InChI | InChI=1S/C17H23N3O/c1-13-9-14(2)11-16(10-13)19(3)7-4-8-20-12-15(18)5-6-17(20)21/h5-6,9-12H,4,7-8,18H2,1-3H3 |
| InChIKey | RWOJWPONDKNKSX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one?
The IUPAC name of 5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one (CID 62001808) is 5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one.
What is the SMILES notation for 5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one?
The canonical SMILES for 5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one is Cc1cc(C)cc(N(C)CCCn2cc(N)ccc2=O)c1.
What is the InChIKey of 5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one?
The InChIKey is RWOJWPONDKNKSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O/c1-13-9-14(2)11-16(10-13)19(3)7-4-8-20-12-15(18)5-6-17(20)21/h5-6,9-12H,4,7-8,18H2,1-3H3.
What are the key properties of 5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one?
5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one has a molecular weight of 285.39 g/mol, XLogP of 2.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-[3-(N,3,5-trimethylanilino)propyl]pyridin-2-one is sourced from PubChem (CID 62001808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).