About N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide
N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide (PubChem CID 62001890) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide.
Molecular Properties
| Compound Name | N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide |
| PubChem CID | 62001890 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide |
| SMILES | CCc1ccc(N(C)C(=O)C2CCCC(C)N2)cc1 |
| InChI | InChI=1S/C16H24N2O/c1-4-13-8-10-14(11-9-13)18(3)16(19)15-7-5-6-12(2)17-15/h8-12,15,17H,4-7H2,1-3H3 |
| InChIKey | NEOIWODZVKROSU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide?
The IUPAC name of N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide (CID 62001890) is N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide.
What is the SMILES notation for N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide?
The canonical SMILES for N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide is CCc1ccc(N(C)C(=O)C2CCCC(C)N2)cc1.
What is the InChIKey of N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide?
The InChIKey is NEOIWODZVKROSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O/c1-4-13-8-10-14(11-9-13)18(3)16(19)15-7-5-6-12(2)17-15/h8-12,15,17H,4-7H2,1-3H3.
What are the key properties of N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide?
N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide has a molecular weight of 260.38 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethylphenyl)-N,6-dimethylpiperidine-2-carboxamide is sourced from PubChem (CID 62001890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).