About 2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine
2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine (PubChem CID 62002813) has the molecular formula C19H24N2
and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine.
Molecular Properties
| Compound Name | 2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine |
| PubChem CID | 62002813 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine |
| SMILES | Cc1cc(C)cc(N(C)C2(CN)Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C19H24N2/c1-14-8-15(2)10-18(9-14)21(3)19(13-20)11-16-6-4-5-7-17(16)12-19/h4-10H,11-13,20H2,1-3H3 |
| InChIKey | LNGTYFHYCSYQLS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine?
The IUPAC name of 2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine (CID 62002813) is 2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine.
What is the SMILES notation for 2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine?
The canonical SMILES for 2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine is Cc1cc(C)cc(N(C)C2(CN)Cc3ccccc3C2)c1.
What is the InChIKey of 2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine?
The InChIKey is LNGTYFHYCSYQLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2/c1-14-8-15(2)10-18(9-14)21(3)19(13-20)11-16-6-4-5-7-17(16)12-19/h4-10H,11-13,20H2,1-3H3.
What are the key properties of 2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine?
2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine has a molecular weight of 280.42 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-N-(3,5-dimethylphenyl)-N-methyl-1,3-dihydroinden-2-amine is sourced from PubChem (CID 62002813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).