C11H13F3N2O2 — CID 62004487
methyl 3-[methyl-[3-(trifluoromethyl)-2-pyridinyl]amino]propanoate (PubChem CID 62004487) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is methyl 3-[methyl-[3-(trifluoromethyl)-2-pyridinyl]amino]propanoate.
| Compound Name | methyl 3-[methyl-[3-(trifluoromethyl)-2-pyridinyl]amino]propanoate |
|---|---|
| PubChem CID | 62004487 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | methyl 3-[methyl-[3-(trifluoromethyl)-2-pyridinyl]amino]propanoate |
| SMILES | COC(=O)CCN(C)c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O2/c1-16(7-5-9(17)18-2)10-8(11(12,13)14)4-3-6-15-10/h3-4,6H,5,7H2,1-2H3 |
| InChIKey | PSZRRCQCCUBALX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |