C11H13F2NO5S — CID 62004536
methyl 2-[2-(difluoromethylsulfonyl)anilino]-3-hydroxypropanoate (PubChem CID 62004536) has the molecular formula C11H13F2NO5S and a molecular weight of 309.29 g/mol. Its IUPAC name is methyl 2-[2-(difluoromethylsulfonyl)anilino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[2-(difluoromethylsulfonyl)anilino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 62004536 |
| Molecular Formula | C11H13F2NO5S |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | methyl 2-[2-(difluoromethylsulfonyl)anilino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)Nc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C11H13F2NO5S/c1-19-10(16)8(6-15)14-7-4-2-3-5-9(7)20(17,18)11(12)13/h2-5,8,11,14-15H,6H2,1H3 |
| InChIKey | NTGNYSHKKBMSFN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |