C11H13ClN2O2 — CID 62005497
methyl 1-(5-chloro-2-pyridinyl)pyrrolidine-2-carboxylate (PubChem CID 62005497) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is methyl 1-(5-chloro-2-pyridinyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(5-chloro-2-pyridinyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 62005497 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | methyl 1-(5-chloro-2-pyridinyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1c1ccc(Cl)cn1 |
| InChI | InChI=1S/C11H13ClN2O2/c1-16-11(15)9-3-2-6-14(9)10-5-4-8(12)7-13-10/h4-5,7,9H,2-3,6H2,1H3 |
| InChIKey | BPYYZJRTLBTADQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |